C21H30N2O4S — CID 170502550
1-[(3aR,4R,6aS)-2-(2-ethylsulfanylacetyl)-4-(4-methoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-methoxypropan-1-one (PubChem CID 170502550) has the molecular formula C21H30N2O4S and a molecular weight of 406.55 g/mol. Its IUPAC name is 1-[(3aR,4R,6aS)-2-(2-ethylsulfanylacetyl)-4-(4-methoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-methoxypropan-1-one.
| Compound Name | 1-[(3aR,4R,6aS)-2-(2-ethylsulfanylacetyl)-4-(4-methoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-methoxypropan-1-one |
|---|---|
| PubChem CID | 170502550 |
| Molecular Formula | C21H30N2O4S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 1-[(3aR,4R,6aS)-2-(2-ethylsulfanylacetyl)-4-(4-methoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-methoxypropan-1-one |
| SMILES | CCSCC(=O)N1C[C@H]2CN(C(=O)CCOC)[C@@H](c3ccc(OC)cc3)[C@H]2C1 |
| InChI | InChI=1S/C21H30N2O4S/c1-4-28-14-20(25)22-11-16-12-23(19(24)9-10-26-2)21(18(16)13-22)15-5-7-17(27-3)8-6-15/h5-8,16,18,21H,4,9-14H2,1-3H3/t16-,18-,21-/m0/s1 |
| InChIKey | WDEGTSDGKYDYQV-MDKPJZGXSA-N |
| XLogP | 2.44 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |