C23H28N2O4 — CID 170504369
1-[(3aR,4R,6aS)-2-(furan-3-carbonyl)-4-(4-methoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]pentan-1-one (PubChem CID 170504369) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 1-[(3aR,4R,6aS)-2-(furan-3-carbonyl)-4-(4-methoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]pentan-1-one.
| Compound Name | 1-[(3aR,4R,6aS)-2-(furan-3-carbonyl)-4-(4-methoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]pentan-1-one |
|---|---|
| PubChem CID | 170504369 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 1-[(3aR,4R,6aS)-2-(furan-3-carbonyl)-4-(4-methoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]pentan-1-one |
| SMILES | CCCCC(=O)N1C[C@@H]2CN(C(=O)c3ccoc3)C[C@@H]2[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-3-4-5-21(26)25-13-18-12-24(23(27)17-10-11-29-15-17)14-20(18)22(25)16-6-8-19(28-2)9-7-16/h6-11,15,18,20,22H,3-5,12-14H2,1-2H3/t18-,20-,22-/m0/s1 |
| InChIKey | VQICLWCVGWXAMI-VCOUNFBDSA-N |
| XLogP | 3.75 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |