C20H22N2O5S — CID 170506006
1-[(3aR,4S,6aS)-5-(furan-3-carbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-methylsulfonylethanone (PubChem CID 170506006) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is 1-[(3aR,4S,6aS)-5-(furan-3-carbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-methylsulfonylethanone.
| Compound Name | 1-[(3aR,4S,6aS)-5-(furan-3-carbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-methylsulfonylethanone |
|---|---|
| PubChem CID | 170506006 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 1-[(3aR,4S,6aS)-5-(furan-3-carbonyl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-methylsulfonylethanone |
| SMILES | CS(=O)(=O)CC(=O)N1C[C@H]2CN(C(=O)c3ccoc3)[C@H](c3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C20H22N2O5S/c1-28(25,26)13-18(23)21-9-16-10-22(20(24)15-7-8-27-12-15)19(17(16)11-21)14-5-3-2-4-6-14/h2-8,12,16-17,19H,9-11,13H2,1H3/t16-,17-,19+/m0/s1 |
| InChIKey | PAIUGMJFOLWFFS-JENIJYKNSA-N |
| XLogP | 1.60 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |