C22H26N2O4S — CID 171909630
[(3aR,4R,6aS)-2-(1,1-dioxothian-4-yl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(furan-3-yl)methanone (PubChem CID 171909630) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is [(3aR,4R,6aS)-2-(1,1-dioxothian-4-yl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(furan-3-yl)methanone.
| Compound Name | [(3aR,4R,6aS)-2-(1,1-dioxothian-4-yl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 171909630 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [(3aR,4R,6aS)-2-(1,1-dioxothian-4-yl)-4-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(furan-3-yl)methanone |
| SMILES | O=C(c1ccoc1)N1C[C@@H]2CN(C3CCS(=O)(=O)CC3)C[C@@H]2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H26N2O4S/c25-22(17-6-9-28-15-17)24-13-18-12-23(19-7-10-29(26,27)11-8-19)14-20(18)21(24)16-4-2-1-3-5-16/h1-6,9,15,18-21H,7-8,10-14H2/t18-,20-,21-/m0/s1 |
| InChIKey | AVLHHZOMEDHVMR-JBACZVJFSA-N |
| XLogP | 2.60 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |