C22H28N4OS — CID 171912569
[(3aR,4S,6aS)-4-phenyl-2-(thian-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-methylpyrazol-3-yl)methanone (PubChem CID 171912569) has the molecular formula C22H28N4OS and a molecular weight of 396.56 g/mol. Its IUPAC name is [(3aR,4S,6aS)-4-phenyl-2-(thian-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-methylpyrazol-3-yl)methanone.
| Compound Name | [(3aR,4S,6aS)-4-phenyl-2-(thian-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 171912569 |
| Molecular Formula | C22H28N4OS |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [(3aR,4S,6aS)-4-phenyl-2-(thian-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-methylpyrazol-3-yl)methanone |
| SMILES | Cn1nccc1C(=O)N1C[C@@H]2CN(C3CCSCC3)C[C@@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H28N4OS/c1-24-20(7-10-23-24)22(27)26-14-17-13-25(18-8-11-28-12-9-18)15-19(17)21(26)16-5-3-2-4-6-16/h2-7,10,17-19,21H,8-9,11-15H2,1H3/t17-,19-,21+/m0/s1 |
| InChIKey | FHORRQZUBCZLOR-HFSMHLIXSA-N |
| XLogP | 3.06 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |