C22H26FN3OS — CID 171912869
[(3aR,4R,6aS)-4-(3-fluorophenyl)-2-(thian-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-pyrrol-2-yl)methanone (PubChem CID 171912869) has the molecular formula C22H26FN3OS and a molecular weight of 399.54 g/mol. Its IUPAC name is [(3aR,4R,6aS)-4-(3-fluorophenyl)-2-(thian-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-pyrrol-2-yl)methanone.
| Compound Name | [(3aR,4R,6aS)-4-(3-fluorophenyl)-2-(thian-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 171912869 |
| Molecular Formula | C22H26FN3OS |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | [(3aR,4R,6aS)-4-(3-fluorophenyl)-2-(thian-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-pyrrol-2-yl)methanone |
| SMILES | O=C(c1ccc[nH]1)N1C[C@@H]2CN(C3CCSCC3)C[C@@H]2[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C22H26FN3OS/c23-17-4-1-3-15(11-17)21-19-14-25(18-6-9-28-10-7-18)12-16(19)13-26(21)22(27)20-5-2-8-24-20/h1-5,8,11,16,18-19,21,24H,6-7,9-10,12-14H2/t16-,19-,21-/m0/s1 |
| InChIKey | RIFRJNYIWFKPGM-LRQRDZAKSA-N |
| XLogP | 3.79 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |