C21H24FN3O4 — CID 166614252
1-[(3aS,4R,6aR)-4-(3-fluorophenyl)-5-(2-methoxyacetyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-(3-methyl-1,2-oxazol-5-yl)ethanone (PubChem CID 166614252) has the molecular formula C21H24FN3O4 and a molecular weight of 401.44 g/mol. Its IUPAC name is 1-[(3aS,4R,6aR)-4-(3-fluorophenyl)-5-(2-methoxyacetyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-(3-methyl-1,2-oxazol-5-yl)ethanone.
| Compound Name | 1-[(3aS,4R,6aR)-4-(3-fluorophenyl)-5-(2-methoxyacetyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-(3-methyl-1,2-oxazol-5-yl)ethanone |
|---|---|
| PubChem CID | 166614252 |
| Molecular Formula | C21H24FN3O4 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 1-[(3aS,4R,6aR)-4-(3-fluorophenyl)-5-(2-methoxyacetyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-2-(3-methyl-1,2-oxazol-5-yl)ethanone |
| SMILES | COCC(=O)N1C[C@H]2CN(C(=O)Cc3cc(C)no3)C[C@H]2[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C21H24FN3O4/c1-13-6-17(29-23-13)8-19(26)24-9-15-10-25(20(27)12-28-2)21(18(15)11-24)14-4-3-5-16(22)7-14/h3-7,15,18,21H,8-12H2,1-2H3/t15-,18-,21+/m1/s1 |
| InChIKey | FRADVPPNIOWWBZ-FPDPHYFHSA-N |
| XLogP | 1.97 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |