C22H27FN4O5 — CID 171329451
(3aS,4R,6aR)-4-(3-fluorophenyl)-N,N-dimethyl-2-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide;formic acid (PubChem CID 171329451) has the molecular formula C22H27FN4O5 and a molecular weight of 446.48 g/mol. Its IUPAC name is (3aS,4R,6aR)-4-(3-fluorophenyl)-N,N-dimethyl-2-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide;formic acid.
| Compound Name | (3aS,4R,6aR)-4-(3-fluorophenyl)-N,N-dimethyl-2-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide;formic acid |
|---|---|
| PubChem CID | 171329451 |
| Molecular Formula | C22H27FN4O5 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | (3aS,4R,6aR)-4-(3-fluorophenyl)-N,N-dimethyl-2-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide;formic acid |
| SMILES | Cc1cc(CC(=O)N2C[C@@H]3CN(C(=O)N(C)C)[C@@H](c4cccc(F)c4)[C@@H]3C2)on1.O=CO |
| InChI | InChI=1S/C21H25FN4O3.CH2O2/c1-13-7-17(29-23-13)9-19(27)25-10-15-11-26(21(28)24(2)3)20(18(15)12-25)14-5-4-6-16(22)8-14;2-1-3/h4-8,15,18,20H,9-12H2,1-3H3;1H,(H,2,3)/t15-,18-,20+;/m1./s1 |
| InChIKey | RDBXSFCFOKLWAF-FOSCJKOFSA-N |
| XLogP | 2.18 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|