C22H29FN4O2 — CID 171386661
1-[(3aR,4R,6aS)-4-(3-fluorophenyl)-2-[2-(1-methylimidazol-2-yl)ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-methoxypropan-1-one (PubChem CID 171386661) has the molecular formula C22H29FN4O2 and a molecular weight of 400.50 g/mol. Its IUPAC name is 1-[(3aR,4R,6aS)-4-(3-fluorophenyl)-2-[2-(1-methylimidazol-2-yl)ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-methoxypropan-1-one.
| Compound Name | 1-[(3aR,4R,6aS)-4-(3-fluorophenyl)-2-[2-(1-methylimidazol-2-yl)ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-methoxypropan-1-one |
|---|---|
| PubChem CID | 171386661 |
| Molecular Formula | C22H29FN4O2 |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 1-[(3aR,4R,6aS)-4-(3-fluorophenyl)-2-[2-(1-methylimidazol-2-yl)ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-methoxypropan-1-one |
| SMILES | COCCC(=O)N1C[C@@H]2CN(CCc3nccn3C)C[C@@H]2[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C22H29FN4O2/c1-25-10-8-24-20(25)6-9-26-13-17-14-27(21(28)7-11-29-2)22(19(17)15-26)16-4-3-5-18(23)12-16/h3-5,8,10,12,17,19,22H,6-7,9,11,13-15H2,1-2H3/t17-,19-,22-/m0/s1 |
| InChIKey | KYEHDJPJEQGHFX-JLMWRMLUSA-N |
| XLogP | 2.27 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |