C23H28ClFN2O2 — CID 171711097
1-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-4-(4-methoxyphenyl)butan-1-one;hydrochloride (PubChem CID 171711097) has the molecular formula C23H28ClFN2O2 and a molecular weight of 418.94 g/mol. Its IUPAC name is 1-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-4-(4-methoxyphenyl)butan-1-one;hydrochloride.
| Compound Name | 1-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-4-(4-methoxyphenyl)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 171711097 |
| Molecular Formula | C23H28ClFN2O2 |
| Molecular Weight | 418.94 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 1-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-4-(4-methoxyphenyl)butan-1-one;hydrochloride |
| SMILES | COc1ccc(CCCC(=O)N2C[C@@H]3CNC[C@@H]3[C@H]2c2cccc(F)c2)cc1.Cl |
| InChI | InChI=1S/C23H27FN2O2.ClH/c1-28-20-10-8-16(9-11-20)4-2-7-22(27)26-15-18-13-25-14-21(18)23(26)17-5-3-6-19(24)12-17;/h3,5-6,8-12,18,21,23,25H,2,4,7,13-15H2,1H3;1H/t18-,21-,23+;/m0./s1 |
| InChIKey | FCWOZZSYCAVZQT-JJIZMATFSA-N |
| XLogP | 4.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.94 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |