C22H25Cl2FN4O — CID 171325777
1-[(3aR,4R,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(2-methyl-3H-benzimidazol-5-yl)ethanone;dihydrochloride (PubChem CID 171325777) has the molecular formula C22H25Cl2FN4O and a molecular weight of 451.37 g/mol. Its IUPAC name is 1-[(3aR,4R,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(2-methyl-3H-benzimidazol-5-yl)ethanone;dihydrochloride.
| Compound Name | 1-[(3aR,4R,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(2-methyl-3H-benzimidazol-5-yl)ethanone;dihydrochloride |
|---|---|
| PubChem CID | 171325777 |
| Molecular Formula | C22H25Cl2FN4O |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 1-[(3aR,4R,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(2-methyl-3H-benzimidazol-5-yl)ethanone;dihydrochloride |
| SMILES | Cc1nc2ccc(CC(=O)N3C[C@@H]4CNC[C@@H]4[C@@H]3c3cccc(F)c3)cc2[nH]1.Cl.Cl |
| InChI | InChI=1S/C22H23FN4O.2ClH/c1-13-25-19-6-5-14(7-20(19)26-13)8-21(28)27-12-16-10-24-11-18(16)22(27)15-3-2-4-17(23)9-15;;/h2-7,9,16,18,22,24H,8,10-12H2,1H3,(H,25,26);2*1H/t16-,18-,22-;;/m0../s1 |
| InChIKey | HQQDYISBHDRTGN-IHEBFKENSA-N |
| XLogP | 3.82 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |