C18H20ClFN4O3 — CID 171707607
5-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-1-methylpyrimidine-2,4-dione;hydrochloride (PubChem CID 171707607) has the molecular formula C18H20ClFN4O3 and a molecular weight of 394.83 g/mol. Its IUPAC name is 5-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-1-methylpyrimidine-2,4-dione;hydrochloride.
| Compound Name | 5-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-1-methylpyrimidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 171707607 |
| Molecular Formula | C18H20ClFN4O3 |
| Molecular Weight | 394.83 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 5-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-1-methylpyrimidine-2,4-dione;hydrochloride |
| SMILES | Cl.Cn1cc(C(=O)N2C[C@@H]3CNC[C@@H]3[C@H]2c2cccc(F)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H19FN4O3.ClH/c1-22-9-14(16(24)21-18(22)26)17(25)23-8-11-6-20-7-13(11)15(23)10-3-2-4-12(19)5-10;/h2-5,9,11,13,15,20H,6-8H2,1H3,(H,21,24,26);1H/t11-,13-,15+;/m0./s1 |
| InChIKey | MTACHHLSZLFLGO-OJTYFHHOSA-N |
| XLogP | 0.67 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.83 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |