C19H26ClFN2O2 — CID 171711299
[(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1-hydroxycyclohexyl)methanone;hydrochloride (PubChem CID 171711299) has the molecular formula C19H26ClFN2O2 and a molecular weight of 368.88 g/mol. Its IUPAC name is [(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1-hydroxycyclohexyl)methanone;hydrochloride.
| Compound Name | [(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1-hydroxycyclohexyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 171711299 |
| Molecular Formula | C19H26ClFN2O2 |
| Molecular Weight | 368.88 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | [(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1-hydroxycyclohexyl)methanone;hydrochloride |
| SMILES | Cl.O=C(N1C[C@@H]2CNC[C@@H]2[C@H]1c1cccc(F)c1)C1(O)CCCCC1 |
| InChI | InChI=1S/C19H25FN2O2.ClH/c20-15-6-4-5-13(9-15)17-16-11-21-10-14(16)12-22(17)18(23)19(24)7-2-1-3-8-19;/h4-6,9,14,16-17,21,24H,1-3,7-8,10-12H2;1H/t14-,16-,17+;/m0./s1 |
| InChIKey | RPHMICCMUMVODF-SZIOFJSKSA-N |
| XLogP | 2.66 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.88 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |