C18H21ClFN3OS — CID 171710345
1-[(3aR,4R,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone;hydrochloride (PubChem CID 171710345) has the molecular formula C18H21ClFN3OS and a molecular weight of 381.90 g/mol. Its IUPAC name is 1-[(3aR,4R,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone;hydrochloride.
| Compound Name | 1-[(3aR,4R,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 171710345 |
| Molecular Formula | C18H21ClFN3OS |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 1-[(3aR,4R,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone;hydrochloride |
| SMILES | Cc1nc(CC(=O)N2C[C@@H]3CNC[C@@H]3[C@@H]2c2cccc(F)c2)cs1.Cl |
| InChI | InChI=1S/C18H20FN3OS.ClH/c1-11-21-15(10-24-11)6-17(23)22-9-13-7-20-8-16(13)18(22)12-3-2-4-14(19)5-12;/h2-5,10,13,16,18,20H,6-9H2,1H3;1H/t13-,16-,18-;/m0./s1 |
| InChIKey | DQPJLSDZXDRYDS-IMEUVMEPSA-N |
| XLogP | 2.97 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |