C16H19ClF4N2O — CID 171709534
1-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-4,4,4-trifluorobutan-1-one;hydrochloride (PubChem CID 171709534) has the molecular formula C16H19ClF4N2O and a molecular weight of 366.79 g/mol. Its IUPAC name is 1-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-4,4,4-trifluorobutan-1-one;hydrochloride.
| Compound Name | 1-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-4,4,4-trifluorobutan-1-one;hydrochloride |
|---|---|
| PubChem CID | 171709534 |
| Molecular Formula | C16H19ClF4N2O |
| Molecular Weight | 366.79 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 1-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-4,4,4-trifluorobutan-1-one;hydrochloride |
| SMILES | Cl.O=C(CCC(F)(F)F)N1C[C@@H]2CNC[C@@H]2[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C16H18F4N2O.ClH/c17-12-3-1-2-10(6-12)15-13-8-21-7-11(13)9-22(15)14(23)4-5-16(18,19)20;/h1-3,6,11,13,15,21H,4-5,7-9H2;1H/t11-,13-,15+;/m0./s1 |
| InChIKey | ODEXLLDZZYCEFB-OJTYFHHOSA-N |
| XLogP | 3.31 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.79 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |