C20H29ClN2O — CID 171709417
1-[(3aR,4S,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-cyclopentylpropan-1-one;hydrochloride (PubChem CID 171709417) has the molecular formula C20H29ClN2O and a molecular weight of 348.92 g/mol. Its IUPAC name is 1-[(3aR,4S,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-cyclopentylpropan-1-one;hydrochloride.
| Compound Name | 1-[(3aR,4S,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-cyclopentylpropan-1-one;hydrochloride |
|---|---|
| PubChem CID | 171709417 |
| Molecular Formula | C20H29ClN2O |
| Molecular Weight | 348.92 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 1-[(3aR,4S,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-3-cyclopentylpropan-1-one;hydrochloride |
| SMILES | Cl.O=C(CCC1CCCC1)N1C[C@@H]2CNC[C@@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H28N2O.ClH/c23-19(11-10-15-6-4-5-7-15)22-14-17-12-21-13-18(17)20(22)16-8-2-1-3-9-16;/h1-3,8-9,15,17-18,20-21H,4-7,10-14H2;1H/t17-,18-,20+;/m0./s1 |
| InChIKey | YEGXJZANOWZEIJ-RYODLJSBSA-N |
| XLogP | 3.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.92 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |