C21H24N2O3S — CID 166622753
1-[(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-methylsulfonylphenyl)ethanone (PubChem CID 166622753) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is 1-[(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-methylsulfonylphenyl)ethanone.
| Compound Name | 1-[(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-methylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 166622753 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 1-[(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-methylsulfonylphenyl)ethanone |
| SMILES | CS(=O)(=O)c1ccc(CC(=O)N2C[C@@H]3CNC[C@@H]3[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24N2O3S/c1-27(25,26)18-9-7-15(8-10-18)11-20(24)23-14-17-12-22-13-19(17)21(23)16-5-3-2-4-6-16/h2-10,17,19,21-22H,11-14H2,1H3/t17-,19-,21-/m0/s1 |
| InChIKey | CUXXPXIYYYZACZ-CUWPLCDZSA-N |
| XLogP | 2.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |