C21H26Cl2FN3O — CID 171325887
[(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-(2-aminoethyl)-2-fluorophenyl]methanone;dihydrochloride (PubChem CID 171325887) has the molecular formula C21H26Cl2FN3O and a molecular weight of 426.36 g/mol. Its IUPAC name is [(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-(2-aminoethyl)-2-fluorophenyl]methanone;dihydrochloride.
| Compound Name | [(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-(2-aminoethyl)-2-fluorophenyl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 171325887 |
| Molecular Formula | C21H26Cl2FN3O |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | [(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-(2-aminoethyl)-2-fluorophenyl]methanone;dihydrochloride |
| SMILES | Cl.Cl.NCCc1ccc(F)c(C(=O)N2C[C@@H]3CNC[C@@H]3[C@@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C21H24FN3O.2ClH/c22-19-7-6-14(8-9-23)10-17(19)21(26)25-13-16-11-24-12-18(16)20(25)15-4-2-1-3-5-15;;/h1-7,10,16,18,20,24H,8-9,11-13,23H2;2*1H/t16-,18-,20-;;/m0../s1 |
| InChIKey | RXTNZXCIMWHDGA-CUMUDBDASA-N |
| XLogP | 3.20 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |