C23H25Cl2N5O — CID 171339573
[(3aR,4S,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[3-(2-aminopyrimidin-5-yl)phenyl]methanone;dihydrochloride (PubChem CID 171339573) has the molecular formula C23H25Cl2N5O and a molecular weight of 458.39 g/mol. Its IUPAC name is [(3aR,4S,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[3-(2-aminopyrimidin-5-yl)phenyl]methanone;dihydrochloride.
| Compound Name | [(3aR,4S,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[3-(2-aminopyrimidin-5-yl)phenyl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 171339573 |
| Molecular Formula | C23H25Cl2N5O |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | [(3aR,4S,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[3-(2-aminopyrimidin-5-yl)phenyl]methanone;dihydrochloride |
| SMILES | Cl.Cl.Nc1ncc(-c2cccc(C(=O)N3C[C@@H]4CNC[C@@H]4[C@H]3c3ccccc3)c2)cn1 |
| InChI | InChI=1S/C23H23N5O.2ClH/c24-23-26-11-18(12-27-23)16-7-4-8-17(9-16)22(29)28-14-19-10-25-13-20(19)21(28)15-5-2-1-3-6-15;;/h1-9,11-12,19-21,25H,10,13-14H2,(H2,24,26,27);2*1H/t19-,20-,21+;;/m0../s1 |
| InChIKey | PCBOORNQNMJYNW-LNBFQBHWSA-N |
| XLogP | 3.60 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |