C24H31Cl2N5O2 — CID 171325473
[(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(2-methoxyethylamino)-1-methylbenzimidazol-5-yl]methanone;dihydrochloride (PubChem CID 171325473) has the molecular formula C24H31Cl2N5O2 and a molecular weight of 492.45 g/mol. Its IUPAC name is [(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(2-methoxyethylamino)-1-methylbenzimidazol-5-yl]methanone;dihydrochloride.
| Compound Name | [(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(2-methoxyethylamino)-1-methylbenzimidazol-5-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 171325473 |
| Molecular Formula | C24H31Cl2N5O2 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | [(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(2-methoxyethylamino)-1-methylbenzimidazol-5-yl]methanone;dihydrochloride |
| SMILES | COCCNc1nc2cc(C(=O)N3C[C@@H]4CNC[C@@H]4[C@@H]3c3ccccc3)ccc2n1C.Cl.Cl |
| InChI | InChI=1S/C24H29N5O2.2ClH/c1-28-21-9-8-17(12-20(21)27-24(28)26-10-11-31-2)23(30)29-15-18-13-25-14-19(18)22(29)16-6-4-3-5-7-16;;/h3-9,12,18-19,22,25H,10-11,13-15H2,1-2H3,(H,26,27);2*1H/t18-,19-,22-;;/m0../s1 |
| InChIKey | LTAIHCGYQYQTAW-UHKUWVFFSA-N |
| XLogP | 3.51 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|