C22H27ClN2O3 — CID 171711394
1-[(3aR,4S,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(2,4-dimethoxyphenyl)ethanone;hydrochloride (PubChem CID 171711394) has the molecular formula C22H27ClN2O3 and a molecular weight of 402.92 g/mol. Its IUPAC name is 1-[(3aR,4S,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(2,4-dimethoxyphenyl)ethanone;hydrochloride.
| Compound Name | 1-[(3aR,4S,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(2,4-dimethoxyphenyl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 171711394 |
| Molecular Formula | C22H27ClN2O3 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-[(3aR,4S,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(2,4-dimethoxyphenyl)ethanone;hydrochloride |
| SMILES | COc1ccc(CC(=O)N2C[C@@H]3CNC[C@@H]3[C@H]2c2ccccc2)c(OC)c1.Cl |
| InChI | InChI=1S/C22H26N2O3.ClH/c1-26-18-9-8-16(20(11-18)27-2)10-21(25)24-14-17-12-23-13-19(17)22(24)15-6-4-3-5-7-15;/h3-9,11,17,19,22-23H,10,12-14H2,1-2H3;1H/t17-,19-,22+;/m0./s1 |
| InChIKey | VOQDTLYXSLLUQX-YTOMXPGSSA-N |
| XLogP | 3.09 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |