C23H33N3O5 — CID 171708076
1-[2-[(3aR,4S,6aS)-4-(4-methoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]azepan-2-one;acetic acid (PubChem CID 171708076) has the molecular formula C23H33N3O5 and a molecular weight of 431.53 g/mol. Its IUPAC name is 1-[2-[(3aR,4S,6aS)-4-(4-methoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]azepan-2-one;acetic acid.
| Compound Name | 1-[2-[(3aR,4S,6aS)-4-(4-methoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]azepan-2-one;acetic acid |
|---|---|
| PubChem CID | 171708076 |
| Molecular Formula | C23H33N3O5 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 1-[2-[(3aR,4S,6aS)-4-(4-methoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-oxoethyl]azepan-2-one;acetic acid |
| SMILES | CC(=O)O.COc1ccc([C@@H]2[C@H]3CNC[C@H]3CN2C(=O)CN2CCCCCC2=O)cc1 |
| InChI | InChI=1S/C21H29N3O3.C2H4O2/c1-27-17-8-6-15(7-9-17)21-18-12-22-11-16(18)13-24(21)20(26)14-23-10-4-2-3-5-19(23)25;1-2(3)4/h6-9,16,18,21-22H,2-5,10-14H2,1H3;1H3,(H,3,4)/t16-,18-,21+;/m0./s1 |
| InChIKey | QERLMMINBWIONN-OZUMPETPSA-N |
| XLogP | 1.91 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |