C18H22Cl2N4O2 — CID 171709714
[(3aR,4R,6aS)-4-(4-methoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(4-chloro-1-methylpyrazol-5-yl)methanone;hydrochloride (PubChem CID 171709714) has the molecular formula C18H22Cl2N4O2 and a molecular weight of 397.31 g/mol. Its IUPAC name is [(3aR,4R,6aS)-4-(4-methoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(4-chloro-1-methylpyrazol-5-yl)methanone;hydrochloride.
| Compound Name | [(3aR,4R,6aS)-4-(4-methoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(4-chloro-1-methylpyrazol-5-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 171709714 |
| Molecular Formula | C18H22Cl2N4O2 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | [(3aR,4R,6aS)-4-(4-methoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(4-chloro-1-methylpyrazol-5-yl)methanone;hydrochloride |
| SMILES | COc1ccc([C@H]2[C@H]3CNC[C@H]3CN2C(=O)c2c(Cl)cnn2C)cc1.Cl |
| InChI | InChI=1S/C18H21ClN4O2.ClH/c1-22-17(15(19)9-21-22)18(24)23-10-12-7-20-8-14(12)16(23)11-3-5-13(25-2)6-4-11;/h3-6,9,12,14,16,20H,7-8,10H2,1-2H3;1H/t12-,14-,16-;/m0./s1 |
| InChIKey | ATSISQFQCHOPDE-SAJNASKISA-N |
| XLogP | 2.54 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |