C19H19Cl2FN2O — CID 171708691
[(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(3-chloro-4-fluorophenyl)methanone;hydrochloride (PubChem CID 171708691) has the molecular formula C19H19Cl2FN2O and a molecular weight of 381.28 g/mol. Its IUPAC name is [(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(3-chloro-4-fluorophenyl)methanone;hydrochloride.
| Compound Name | [(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(3-chloro-4-fluorophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 171708691 |
| Molecular Formula | C19H19Cl2FN2O |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | [(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(3-chloro-4-fluorophenyl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc(F)c(Cl)c1)N1C[C@@H]2CNC[C@@H]2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H18ClFN2O.ClH/c20-16-8-13(6-7-17(16)21)19(24)23-11-14-9-22-10-15(14)18(23)12-4-2-1-3-5-12;/h1-8,14-15,18,22H,9-11H2;1H/t14-,15-,18-;/m0./s1 |
| InChIKey | AWRSOVIKHWJIAS-IQSXRGEESA-N |
| XLogP | 3.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |