C20H25Cl2N3O — CID 171325216
[(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(5,6-dimethyl-3-pyridinyl)methanone;dihydrochloride (PubChem CID 171325216) has the molecular formula C20H25Cl2N3O and a molecular weight of 394.35 g/mol. Its IUPAC name is [(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(5,6-dimethyl-3-pyridinyl)methanone;dihydrochloride.
| Compound Name | [(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(5,6-dimethyl-3-pyridinyl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 171325216 |
| Molecular Formula | C20H25Cl2N3O |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(5,6-dimethyl-3-pyridinyl)methanone;dihydrochloride |
| SMILES | Cc1cc(C(=O)N2C[C@@H]3CNC[C@@H]3[C@@H]2c2ccccc2)cnc1C.Cl.Cl |
| InChI | InChI=1S/C20H23N3O.2ClH/c1-13-8-16(10-22-14(13)2)20(24)23-12-17-9-21-11-18(17)19(23)15-6-4-3-5-7-15;;/h3-8,10,17-19,21H,9,11-12H2,1-2H3;2*1H/t17-,18-,19-;;/m0../s1 |
| InChIKey | LPKPTGVFTNFACO-KXJNLPJSSA-N |
| XLogP | 3.57 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |