C17H22Cl2N4OS — CID 171324926
[(3aR,4R,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-amino-1,3-thiazol-5-yl)methanone;dihydrochloride (PubChem CID 171324926) has the molecular formula C17H22Cl2N4OS and a molecular weight of 401.36 g/mol. Its IUPAC name is [(3aR,4R,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-amino-1,3-thiazol-5-yl)methanone;dihydrochloride.
| Compound Name | [(3aR,4R,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-amino-1,3-thiazol-5-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 171324926 |
| Molecular Formula | C17H22Cl2N4OS |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | [(3aR,4R,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-amino-1,3-thiazol-5-yl)methanone;dihydrochloride |
| SMILES | Cc1ccccc1[C@H]1[C@H]2CNC[C@H]2CN1C(=O)c1cnc(N)s1.Cl.Cl |
| InChI | InChI=1S/C17H20N4OS.2ClH/c1-10-4-2-3-5-12(10)15-13-7-19-6-11(13)9-21(15)16(22)14-8-20-17(18)23-14;;/h2-5,8,11,13,15,19H,6-7,9H2,1H3,(H2,18,20);2*1H/t11-,13-,15-;;/m0../s1 |
| InChIKey | IUCPMADHOHOBIK-RFHHAFCRSA-N |
| XLogP | 2.91 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |