C20H27ClN4O — CID 171711970
[(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-ethyl-5-methylpyrazol-3-yl)methanone;hydrochloride (PubChem CID 171711970) has the molecular formula C20H27ClN4O and a molecular weight of 374.92 g/mol. Its IUPAC name is [(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-ethyl-5-methylpyrazol-3-yl)methanone;hydrochloride.
| Compound Name | [(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-ethyl-5-methylpyrazol-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 171711970 |
| Molecular Formula | C20H27ClN4O |
| Molecular Weight | 374.92 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | [(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-ethyl-5-methylpyrazol-3-yl)methanone;hydrochloride |
| SMILES | CCn1nc(C)cc1C(=O)N1C[C@@H]2CNC[C@@H]2[C@H]1c1ccccc1C.Cl |
| InChI | InChI=1S/C20H26N4O.ClH/c1-4-24-18(9-14(3)22-24)20(25)23-12-15-10-21-11-17(15)19(23)16-8-6-5-7-13(16)2;/h5-9,15,17,19,21H,4,10-12H2,1-3H3;1H/t15-,17-,19+;/m0./s1 |
| InChIKey | YUYRKKSAFBRPIJ-UEXRLZNCSA-N |
| XLogP | 2.97 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.92 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |