C22H24ClN3OS — CID 171706886
[(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-methyl-1,3-benzothiazol-6-yl)methanone;hydrochloride (PubChem CID 171706886) has the molecular formula C22H24ClN3OS and a molecular weight of 413.97 g/mol. Its IUPAC name is [(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-methyl-1,3-benzothiazol-6-yl)methanone;hydrochloride.
| Compound Name | [(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-methyl-1,3-benzothiazol-6-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 171706886 |
| Molecular Formula | C22H24ClN3OS |
| Molecular Weight | 413.97 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | [(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(2-methyl-1,3-benzothiazol-6-yl)methanone;hydrochloride |
| SMILES | Cc1nc2ccc(C(=O)N3C[C@@H]4CNC[C@@H]4[C@H]3c3ccccc3C)cc2s1.Cl |
| InChI | InChI=1S/C22H23N3OS.ClH/c1-13-5-3-4-6-17(13)21-18-11-23-10-16(18)12-25(21)22(26)15-7-8-19-20(9-15)27-14(2)24-19;/h3-9,16,18,21,23H,10-12H2,1-2H3;1H/t16-,18-,21+;/m0./s1 |
| InChIKey | WHFUSJNQJHHDRG-OZUMPETPSA-N |
| XLogP | 4.37 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.97 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |