C19H26ClN5O — CID 171709560
1-[(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(5-amino-3-methylpyrazol-1-yl)ethanone;hydrochloride (PubChem CID 171709560) has the molecular formula C19H26ClN5O and a molecular weight of 375.90 g/mol. Its IUPAC name is 1-[(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(5-amino-3-methylpyrazol-1-yl)ethanone;hydrochloride.
| Compound Name | 1-[(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(5-amino-3-methylpyrazol-1-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 171709560 |
| Molecular Formula | C19H26ClN5O |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 1-[(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(5-amino-3-methylpyrazol-1-yl)ethanone;hydrochloride |
| SMILES | Cc1cc(N)n(CC(=O)N2C[C@@H]3CNC[C@@H]3[C@H]2c2ccccc2C)n1.Cl |
| InChI | InChI=1S/C19H25N5O.ClH/c1-12-5-3-4-6-15(12)19-16-9-21-8-14(16)10-23(19)18(25)11-24-17(20)7-13(2)22-24;/h3-7,14,16,19,21H,8-11,20H2,1-2H3;1H/t14-,16-,19+;/m0./s1 |
| InChIKey | UYCJGWDOBBGNKQ-LLHWHPBOSA-N |
| XLogP | 1.92 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |