C26H35Cl2N3O — CID 171325388
[(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1-methyl-4-phenylpiperidin-4-yl)methanone;dihydrochloride (PubChem CID 171325388) has the molecular formula C26H35Cl2N3O and a molecular weight of 476.49 g/mol. Its IUPAC name is [(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1-methyl-4-phenylpiperidin-4-yl)methanone;dihydrochloride.
| Compound Name | [(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1-methyl-4-phenylpiperidin-4-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 171325388 |
| Molecular Formula | C26H35Cl2N3O |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | [(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1-methyl-4-phenylpiperidin-4-yl)methanone;dihydrochloride |
| SMILES | Cc1ccccc1[C@@H]1[C@H]2CNC[C@H]2CN1C(=O)C1(c2ccccc2)CCN(C)CC1.Cl.Cl |
| InChI | InChI=1S/C26H33N3O.2ClH/c1-19-8-6-7-11-22(19)24-23-17-27-16-20(23)18-29(24)25(30)26(12-14-28(2)15-13-26)21-9-4-3-5-10-21;;/h3-11,20,23-24,27H,12-18H2,1-2H3;2*1H/t20-,23-,24+;;/m0../s1 |
| InChIKey | SBSSHUYZZVEBOJ-VOXPPZSUSA-N |
| XLogP | 4.22 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |