C24H30Cl2FN3O — CID 171325784
[(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[3-[(2-fluorophenyl)methyl]azetidin-3-yl]methanone;dihydrochloride (PubChem CID 171325784) has the molecular formula C24H30Cl2FN3O and a molecular weight of 466.43 g/mol. Its IUPAC name is [(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[3-[(2-fluorophenyl)methyl]azetidin-3-yl]methanone;dihydrochloride.
| Compound Name | [(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[3-[(2-fluorophenyl)methyl]azetidin-3-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 171325784 |
| Molecular Formula | C24H30Cl2FN3O |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | [(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[3-[(2-fluorophenyl)methyl]azetidin-3-yl]methanone;dihydrochloride |
| SMILES | Cc1ccccc1[C@@H]1[C@H]2CNC[C@H]2CN1C(=O)C1(Cc2ccccc2F)CNC1.Cl.Cl |
| InChI | InChI=1S/C24H28FN3O.2ClH/c1-16-6-2-4-8-19(16)22-20-12-26-11-18(20)13-28(22)23(29)24(14-27-15-24)10-17-7-3-5-9-21(17)25;;/h2-9,18,20,22,26-27H,10-15H2,1H3;2*1H/t18-,20-,22+;;/m0../s1 |
| InChIKey | QKURUYLDOAGTAI-ZIENQUGISA-N |
| XLogP | 3.53 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |