C17H20ClN3O2 — CID 171706818
[(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1,2-oxazol-5-yl)methanone;hydrochloride (PubChem CID 171706818) has the molecular formula C17H20ClN3O2 and a molecular weight of 333.82 g/mol. Its IUPAC name is [(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1,2-oxazol-5-yl)methanone;hydrochloride.
| Compound Name | [(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1,2-oxazol-5-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 171706818 |
| Molecular Formula | C17H20ClN3O2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | [(3aR,4S,6aS)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(1,2-oxazol-5-yl)methanone;hydrochloride |
| SMILES | Cc1ccccc1[C@@H]1[C@H]2CNC[C@H]2CN1C(=O)c1ccno1.Cl |
| InChI | InChI=1S/C17H19N3O2.ClH/c1-11-4-2-3-5-13(11)16-14-9-18-8-12(14)10-20(16)17(21)15-6-7-19-22-15;/h2-7,12,14,16,18H,8-10H2,1H3;1H/t12-,14-,16+;/m0./s1 |
| InChIKey | CDYVAHIYFGWLEG-KRTONYTCSA-N |
| XLogP | 2.44 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |