C19H23ClN2O2S — CID 171709505
(3aR,4S,6aS)-5-(benzenesulfonyl)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 171709505) has the molecular formula C19H23ClN2O2S and a molecular weight of 378.93 g/mol. Its IUPAC name is (3aR,4S,6aS)-5-(benzenesulfonyl)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3aR,4S,6aS)-5-(benzenesulfonyl)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 171709505 |
| Molecular Formula | C19H23ClN2O2S |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (3aR,4S,6aS)-5-(benzenesulfonyl)-4-(2-methylphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | Cc1ccccc1[C@@H]1[C@H]2CNC[C@H]2CN1S(=O)(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C19H22N2O2S.ClH/c1-14-7-5-6-10-17(14)19-18-12-20-11-15(18)13-21(19)24(22,23)16-8-3-2-4-9-16;/h2-10,15,18-20H,11-13H2,1H3;1H/t15-,18-,19+;/m0./s1 |
| InChIKey | WHUXYRWYMKNWAC-MFARMMKMSA-N |
| XLogP | 3.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |