C21H26ClN3O — CID 171711441
[(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-(dimethylamino)phenyl]methanone;hydrochloride (PubChem CID 171711441) has the molecular formula C21H26ClN3O and a molecular weight of 371.91 g/mol. Its IUPAC name is [(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-(dimethylamino)phenyl]methanone;hydrochloride.
| Compound Name | [(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-(dimethylamino)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 171711441 |
| Molecular Formula | C21H26ClN3O |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | [(3aR,4R,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-(dimethylamino)phenyl]methanone;hydrochloride |
| SMILES | CN(C)c1ccc(C(=O)N2C[C@@H]3CNC[C@@H]3[C@@H]2c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C21H25N3O.ClH/c1-23(2)18-10-8-16(9-11-18)21(25)24-14-17-12-22-13-19(17)20(24)15-6-4-3-5-7-15;/h3-11,17,19-20,22H,12-14H2,1-2H3;1H/t17-,19-,20-;/m0./s1 |
| InChIKey | UZZCMQQWAQULSF-QEXYDYNRSA-N |
| XLogP | 3.21 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |