C23H31Cl2N5O — CID 171686642
[(3aR,4S,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(4-methyl-2-piperidin-1-ylpyrimidin-5-yl)methanone;dihydrochloride (PubChem CID 171686642) has the molecular formula C23H31Cl2N5O and a molecular weight of 464.44 g/mol. Its IUPAC name is [(3aR,4S,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(4-methyl-2-piperidin-1-ylpyrimidin-5-yl)methanone;dihydrochloride.
| Compound Name | [(3aR,4S,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(4-methyl-2-piperidin-1-ylpyrimidin-5-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 171686642 |
| Molecular Formula | C23H31Cl2N5O |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | [(3aR,4S,6aS)-4-phenyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(4-methyl-2-piperidin-1-ylpyrimidin-5-yl)methanone;dihydrochloride |
| SMILES | Cc1nc(N2CCCCC2)ncc1C(=O)N1C[C@@H]2CNC[C@@H]2[C@H]1c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C23H29N5O.2ClH/c1-16-19(14-25-23(26-16)27-10-6-3-7-11-27)22(29)28-15-18-12-24-13-20(18)21(28)17-8-4-2-5-9-17;;/h2,4-5,8-9,14,18,20-21,24H,3,6-7,10-13,15H2,1H3;2*1H/t18-,20-,21+;;/m0../s1 |
| InChIKey | VEGLPMWDKGKWGW-VYEOLCPUSA-N |
| XLogP | 3.65 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |