C21H24ClFN2O3 — CID 171710235
[(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(3,5-dimethoxyphenyl)methanone;hydrochloride (PubChem CID 171710235) has the molecular formula C21H24ClFN2O3 and a molecular weight of 406.89 g/mol. Its IUPAC name is [(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(3,5-dimethoxyphenyl)methanone;hydrochloride.
| Compound Name | [(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(3,5-dimethoxyphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 171710235 |
| Molecular Formula | C21H24ClFN2O3 |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | [(3aR,4S,6aS)-4-(3-fluorophenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(3,5-dimethoxyphenyl)methanone;hydrochloride |
| SMILES | COc1cc(OC)cc(C(=O)N2C[C@@H]3CNC[C@@H]3[C@H]2c2cccc(F)c2)c1.Cl |
| InChI | InChI=1S/C21H23FN2O3.ClH/c1-26-17-7-14(8-18(9-17)27-2)21(25)24-12-15-10-23-11-19(15)20(24)13-4-3-5-16(22)6-13;/h3-9,15,19-20,23H,10-12H2,1-2H3;1H/t15-,19-,20+;/m0./s1 |
| InChIKey | WFRVTYAOXFORFA-BNYGDTNWSA-N |
| XLogP | 3.30 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |