C24H25ClFN3O2 — CID 171711942
[(3aR,4S,6aS)-4-(4-methoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(7-fluoro-2-methylquinolin-4-yl)methanone;hydrochloride (PubChem CID 171711942) has the molecular formula C24H25ClFN3O2 and a molecular weight of 441.93 g/mol. Its IUPAC name is [(3aR,4S,6aS)-4-(4-methoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(7-fluoro-2-methylquinolin-4-yl)methanone;hydrochloride.
| Compound Name | [(3aR,4S,6aS)-4-(4-methoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(7-fluoro-2-methylquinolin-4-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 171711942 |
| Molecular Formula | C24H25ClFN3O2 |
| Molecular Weight | 441.93 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | [(3aR,4S,6aS)-4-(4-methoxyphenyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-(7-fluoro-2-methylquinolin-4-yl)methanone;hydrochloride |
| SMILES | COc1ccc([C@@H]2[C@H]3CNC[C@H]3CN2C(=O)c2cc(C)nc3cc(F)ccc23)cc1.Cl |
| InChI | InChI=1S/C24H24FN3O2.ClH/c1-14-9-20(19-8-5-17(25)10-22(19)27-14)24(29)28-13-16-11-26-12-21(16)23(28)15-3-6-18(30-2)7-4-15;/h3-10,16,21,23,26H,11-13H2,1-2H3;1H/t16-,21-,23+;/m0./s1 |
| InChIKey | BDWVQPSQNSVWFX-JQMNMTLPSA-N |
| XLogP | 4.15 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.93 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |