C20H16F2N2O — CID 70738729
(7-fluoro-2-methylquinolin-4-yl)-[2-(4-fluorophenyl)azetidin-1-yl]methanone (PubChem CID 70738729) has the molecular formula C20H16F2N2O and a molecular weight of 338.36 g/mol. Its IUPAC name is (7-fluoro-2-methylquinolin-4-yl)-[2-(4-fluorophenyl)azetidin-1-yl]methanone.
| Compound Name | (7-fluoro-2-methylquinolin-4-yl)-[2-(4-fluorophenyl)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 70738729 |
| Molecular Formula | C20H16F2N2O |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (7-fluoro-2-methylquinolin-4-yl)-[2-(4-fluorophenyl)azetidin-1-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCC2c2ccc(F)cc2)c2ccc(F)cc2n1 |
| InChI | InChI=1S/C20H16F2N2O/c1-12-10-17(16-7-6-15(22)11-18(16)23-12)20(25)24-9-8-19(24)13-2-4-14(21)5-3-13/h2-7,10-11,19H,8-9H2,1H3 |
| InChIKey | YJUXLLZQIZRZBV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |