C20H22FN3O3 — CID 94091057
[4-(7-fluoro-2-methylquinoline-4-carbonyl)piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone (PubChem CID 94091057) has the molecular formula C20H22FN3O3 and a molecular weight of 371.41 g/mol. Its IUPAC name is [4-(7-fluoro-2-methylquinoline-4-carbonyl)piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone.
| Compound Name | [4-(7-fluoro-2-methylquinoline-4-carbonyl)piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 94091057 |
| Molecular Formula | C20H22FN3O3 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | [4-(7-fluoro-2-methylquinoline-4-carbonyl)piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCN(C(=O)[C@@H]3CCCO3)CC2)c2ccc(F)cc2n1 |
| InChI | InChI=1S/C20H22FN3O3/c1-13-11-16(15-5-4-14(21)12-17(15)22-13)19(25)23-6-8-24(9-7-23)20(26)18-3-2-10-27-18/h4-5,11-12,18H,2-3,6-10H2,1H3/t18-/m0/s1 |
| InChIKey | JTQJGKKGXMKHSG-SFHVURJKSA-N |
| XLogP | 2.15 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |