C19H21FN2O2 — CID 70732609
[(3aS,6aS)-3a-(hydroxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(7-fluoro-2-methylquinolin-4-yl)methanone (PubChem CID 70732609) has the molecular formula C19H21FN2O2 and a molecular weight of 328.39 g/mol. Its IUPAC name is [(3aS,6aS)-3a-(hydroxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(7-fluoro-2-methylquinolin-4-yl)methanone.
| Compound Name | [(3aS,6aS)-3a-(hydroxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(7-fluoro-2-methylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 70732609 |
| Molecular Formula | C19H21FN2O2 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | [(3aS,6aS)-3a-(hydroxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(7-fluoro-2-methylquinolin-4-yl)methanone |
| SMILES | Cc1cc(C(=O)N2C[C@H]3CCC[C@@]3(CO)C2)c2ccc(F)cc2n1 |
| InChI | InChI=1S/C19H21FN2O2/c1-12-7-16(15-5-4-14(20)8-17(15)21-12)18(24)22-9-13-3-2-6-19(13,10-22)11-23/h4-5,7-8,13,23H,2-3,6,9-11H2,1H3/t13-,19+/m1/s1 |
| InChIKey | DJNJHQCGCGMTLE-YJYMSZOUSA-N |
| XLogP | 2.92 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |