C26H30FN3O2 — CID 46686968
[4-(adamantane-1-carbonyl)piperazin-1-yl]-(7-fluoro-2-methylquinolin-4-yl)methanone (PubChem CID 46686968) has the molecular formula C26H30FN3O2 and a molecular weight of 435.54 g/mol. Its IUPAC name is [4-(adamantane-1-carbonyl)piperazin-1-yl]-(7-fluoro-2-methylquinolin-4-yl)methanone.
| Compound Name | [4-(adamantane-1-carbonyl)piperazin-1-yl]-(7-fluoro-2-methylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 46686968 |
| Molecular Formula | C26H30FN3O2 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | [4-(adamantane-1-carbonyl)piperazin-1-yl]-(7-fluoro-2-methylquinolin-4-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCN(C(=O)C34CC5CC(CC(C5)C3)C4)CC2)c2ccc(F)cc2n1 |
| InChI | InChI=1S/C26H30FN3O2/c1-16-8-22(21-3-2-20(27)12-23(21)28-16)24(31)29-4-6-30(7-5-29)25(32)26-13-17-9-18(14-26)11-19(10-17)15-26/h2-3,8,12,17-19H,4-7,9-11,13-15H2,1H3 |
| InChIKey | ZHRIOSAMEMXUAJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |