C21H19F2N3O — CID 55604624
(7-fluoro-2-methylquinolin-4-yl)-[4-(4-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 55604624) has the molecular formula C21H19F2N3O and a molecular weight of 367.40 g/mol. Its IUPAC name is (7-fluoro-2-methylquinolin-4-yl)-[4-(4-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | (7-fluoro-2-methylquinolin-4-yl)-[4-(4-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55604624 |
| Molecular Formula | C21H19F2N3O |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (7-fluoro-2-methylquinolin-4-yl)-[4-(4-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCN(c3ccc(F)cc3)CC2)c2ccc(F)cc2n1 |
| InChI | InChI=1S/C21H19F2N3O/c1-14-12-19(18-7-4-16(23)13-20(18)24-14)21(27)26-10-8-25(9-11-26)17-5-2-15(22)3-6-17/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | LCLOZOBXMYUERJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |