C21H26FN3O — CID 96574367
(7-fluoro-2-methylquinolin-4-yl)-[(2R)-2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]methanone (PubChem CID 96574367) has the molecular formula C21H26FN3O and a molecular weight of 355.46 g/mol. Its IUPAC name is (7-fluoro-2-methylquinolin-4-yl)-[(2R)-2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]methanone.
| Compound Name | (7-fluoro-2-methylquinolin-4-yl)-[(2R)-2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 96574367 |
| Molecular Formula | C21H26FN3O |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (7-fluoro-2-methylquinolin-4-yl)-[(2R)-2-(pyrrolidin-1-ylmethyl)piperidin-1-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCCC[C@@H]2CN2CCCC2)c2ccc(F)cc2n1 |
| InChI | InChI=1S/C21H26FN3O/c1-15-12-19(18-8-7-16(22)13-20(18)23-15)21(26)25-11-3-2-6-17(25)14-24-9-4-5-10-24/h7-8,12-13,17H,2-6,9-11,14H2,1H3/t17-/m1/s1 |
| InChIKey | VLQIPPLRZSMMPH-QGZVFWFLSA-N |
| XLogP | 3.77 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |