C19H21FN2O3 — CID 124697534
3-[(2R)-1-(7-fluoro-2-methylquinoline-3-carbonyl)piperidin-2-yl]propanoic acid (PubChem CID 124697534) has the molecular formula C19H21FN2O3 and a molecular weight of 344.39 g/mol. Its IUPAC name is 3-[(2R)-1-(7-fluoro-2-methylquinoline-3-carbonyl)piperidin-2-yl]propanoic acid.
| Compound Name | 3-[(2R)-1-(7-fluoro-2-methylquinoline-3-carbonyl)piperidin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 124697534 |
| Molecular Formula | C19H21FN2O3 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 3-[(2R)-1-(7-fluoro-2-methylquinoline-3-carbonyl)piperidin-2-yl]propanoic acid |
| SMILES | Cc1nc2cc(F)ccc2cc1C(=O)N1CCCC[C@@H]1CCC(=O)O |
| InChI | InChI=1S/C19H21FN2O3/c1-12-16(10-13-5-6-14(20)11-17(13)21-12)19(25)22-9-3-2-4-15(22)7-8-18(23)24/h5-6,10-11,15H,2-4,7-9H2,1H3,(H,23,24)/t15-/m1/s1 |
| InChIKey | HFAIRAMCNAZVNZ-OAHLLOKOSA-N |
| XLogP | 3.54 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |