C18H19FN2O2 — CID 94643322
[(4aR,7aS)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(7-fluoro-2-methylquinolin-3-yl)methanone (PubChem CID 94643322) has the molecular formula C18H19FN2O2 and a molecular weight of 314.36 g/mol. Its IUPAC name is [(4aR,7aS)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(7-fluoro-2-methylquinolin-3-yl)methanone.
| Compound Name | [(4aR,7aS)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(7-fluoro-2-methylquinolin-3-yl)methanone |
|---|---|
| PubChem CID | 94643322 |
| Molecular Formula | C18H19FN2O2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | [(4aR,7aS)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(7-fluoro-2-methylquinolin-3-yl)methanone |
| SMILES | Cc1nc2cc(F)ccc2cc1C(=O)N1CCO[C@H]2CCC[C@H]21 |
| InChI | InChI=1S/C18H19FN2O2/c1-11-14(9-12-5-6-13(19)10-15(12)20-11)18(22)21-7-8-23-17-4-2-3-16(17)21/h5-6,9-10,16-17H,2-4,7-8H2,1H3/t16-,17+/m1/s1 |
| InChIKey | NBCLIEABDLFMJB-SJORKVTESA-N |
| XLogP | 3.08 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |