C19H20FNO4 — CID 166283648
2-[(3aS,7aS)-7a-(hydroxymethyl)-3,3a,4,5,6,7-hexahydro-1H-isoindole-2-carbonyl]-7-fluorochromen-4-one (PubChem CID 166283648) has the molecular formula C19H20FNO4 and a molecular weight of 345.37 g/mol. Its IUPAC name is 2-[(3aS,7aS)-7a-(hydroxymethyl)-3,3a,4,5,6,7-hexahydro-1H-isoindole-2-carbonyl]-7-fluorochromen-4-one.
| Compound Name | 2-[(3aS,7aS)-7a-(hydroxymethyl)-3,3a,4,5,6,7-hexahydro-1H-isoindole-2-carbonyl]-7-fluorochromen-4-one |
|---|---|
| PubChem CID | 166283648 |
| Molecular Formula | C19H20FNO4 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-[(3aS,7aS)-7a-(hydroxymethyl)-3,3a,4,5,6,7-hexahydro-1H-isoindole-2-carbonyl]-7-fluorochromen-4-one |
| SMILES | O=C(c1cc(=O)c2ccc(F)cc2o1)N1C[C@H]2CCCC[C@@]2(CO)C1 |
| InChI | InChI=1S/C19H20FNO4/c20-13-4-5-14-15(23)8-17(25-16(14)7-13)18(24)21-9-12-3-1-2-6-19(12,10-21)11-22/h4-5,7-8,12,22H,1-3,6,9-11H2/t12-,19+/m1/s1 |
| InChIKey | WSYLXMZPFIJXMV-BLVKFPJESA-N |
| XLogP | 2.56 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |