C24H24N2O3 — CID 137336697
2-[3a-(2-phenylethyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]chromen-4-one (PubChem CID 137336697) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-[3a-(2-phenylethyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]chromen-4-one.
| Compound Name | 2-[3a-(2-phenylethyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]chromen-4-one |
|---|---|
| PubChem CID | 137336697 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 2-[3a-(2-phenylethyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]chromen-4-one |
| SMILES | O=C(c1cc(=O)c2ccccc2o1)N1CC2CNCC2(CCc2ccccc2)C1 |
| InChI | InChI=1S/C24H24N2O3/c27-20-12-22(29-21-9-5-4-8-19(20)21)23(28)26-14-18-13-25-15-24(18,16-26)11-10-17-6-2-1-3-7-17/h1-9,12,18,25H,10-11,13-16H2 |
| InChIKey | MXDPRTMYLKBZKG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |