C19H22N2O4 — CID 124949038
2-[(3S)-3-hydroxy-3-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carbonyl]chromen-4-one (PubChem CID 124949038) has the molecular formula C19H22N2O4 and a molecular weight of 342.39 g/mol. Its IUPAC name is 2-[(3S)-3-hydroxy-3-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carbonyl]chromen-4-one.
| Compound Name | 2-[(3S)-3-hydroxy-3-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carbonyl]chromen-4-one |
|---|---|
| PubChem CID | 124949038 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-[(3S)-3-hydroxy-3-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carbonyl]chromen-4-one |
| SMILES | O=C(c1cc(=O)c2ccccc2o1)N1CC[C@](O)(CN2CCCC2)C1 |
| InChI | InChI=1S/C19H22N2O4/c22-15-11-17(25-16-6-2-1-5-14(15)16)18(23)21-10-7-19(24,13-21)12-20-8-3-4-9-20/h1-2,5-6,11,24H,3-4,7-10,12-13H2/t19-/m0/s1 |
| InChIKey | CRDMKYKCQYQNGD-IBGZPJMESA-N |
| XLogP | 1.47 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |