C9H18N2O — CID 129497472
[(3aS,7aS)-2-amino-3,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl]methanol (PubChem CID 129497472) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is [(3aS,7aS)-2-amino-3,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl]methanol.
| Compound Name | [(3aS,7aS)-2-amino-3,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl]methanol |
|---|---|
| PubChem CID | 129497472 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | [(3aS,7aS)-2-amino-3,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl]methanol |
| SMILES | NN1C[C@H]2CCCC[C@@]2(CO)C1 |
| InChI | InChI=1S/C9H18N2O/c10-11-5-8-3-1-2-4-9(8,6-11)7-12/h8,12H,1-7,10H2/t8-,9+/m1/s1 |
| InChIKey | GVWWSCLXRZPXFL-BDAKNGLRSA-N |
| XLogP | 0.34 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|