C10H20N2O — CID 121204312
7a-(methoxymethyl)-3,3a,4,5,6,7-hexahydro-1H-isoindol-2-amine (PubChem CID 121204312) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 7a-(methoxymethyl)-3,3a,4,5,6,7-hexahydro-1H-isoindol-2-amine.
| Compound Name | 7a-(methoxymethyl)-3,3a,4,5,6,7-hexahydro-1H-isoindol-2-amine |
|---|---|
| PubChem CID | 121204312 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 7a-(methoxymethyl)-3,3a,4,5,6,7-hexahydro-1H-isoindol-2-amine |
| SMILES | COCC12CCCCC1CN(N)C2 |
| InChI | InChI=1S/C10H20N2O/c1-13-8-10-5-3-2-4-9(10)6-12(11)7-10/h9H,2-8,11H2,1H3 |
| InChIKey | LYSSBTVRCNMKOH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|